C14H20FN5O — CID 105388318
1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-(3-fluoro-2-hydrazinyl-4-pyridinyl)methanone (PubChem CID 105388318) has the molecular formula C14H20FN5O and a molecular weight of 293.35 g/mol. Its IUPAC name is 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-(3-fluoro-2-hydrazinyl-4-pyridinyl)methanone.
| Compound Name | 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-(3-fluoro-2-hydrazinyl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 105388318 |
| Molecular Formula | C14H20FN5O |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-(3-fluoro-2-hydrazinyl-4-pyridinyl)methanone |
| SMILES | NNc1nccc(C(=O)N2CCCN3CCCC3C2)c1F |
| InChI | InChI=1S/C14H20FN5O/c15-12-11(4-5-17-13(12)18-16)14(21)20-8-2-7-19-6-1-3-10(19)9-20/h4-5,10H,1-3,6-9,16H2,(H,17,18) |
| InChIKey | JYQQVCQENURQPF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|