C14H21FN4O — CID 105386748
[3-(dimethylamino)piperidin-1-yl]-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone (PubChem CID 105386748) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is [3-(dimethylamino)piperidin-1-yl]-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone.
| Compound Name | [3-(dimethylamino)piperidin-1-yl]-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 105386748 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [3-(dimethylamino)piperidin-1-yl]-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone |
| SMILES | CNc1nccc(C(=O)N2CCCC(N(C)C)C2)c1F |
| InChI | InChI=1S/C14H21FN4O/c1-16-13-12(15)11(6-7-17-13)14(20)19-8-4-5-10(9-19)18(2)3/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,17) |
| InChIKey | OMOLGDGEVVTFRN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |