C13H18FN3OS — CID 105387603
(2-ethylthiomorpholin-4-yl)-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone (PubChem CID 105387603) has the molecular formula C13H18FN3OS and a molecular weight of 283.37 g/mol. Its IUPAC name is (2-ethylthiomorpholin-4-yl)-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone.
| Compound Name | (2-ethylthiomorpholin-4-yl)-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 105387603 |
| Molecular Formula | C13H18FN3OS |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2-ethylthiomorpholin-4-yl)-[3-fluoro-2-(methylamino)-4-pyridinyl]methanone |
| SMILES | CCC1CN(C(=O)c2ccnc(NC)c2F)CCS1 |
| InChI | InChI=1S/C13H18FN3OS/c1-3-9-8-17(6-7-19-9)13(18)10-4-5-16-12(15-2)11(10)14/h4-5,9H,3,6-8H2,1-2H3,(H,15,16) |
| InChIKey | QPEXUGPZWTZFBP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |