C14H20FN3O2 — CID 102965878
[3-fluoro-2-(methylamino)-4-pyridinyl]-(3-methoxy-4-methylpiperidin-1-yl)methanone (PubChem CID 102965878) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is [3-fluoro-2-(methylamino)-4-pyridinyl]-(3-methoxy-4-methylpiperidin-1-yl)methanone.
| Compound Name | [3-fluoro-2-(methylamino)-4-pyridinyl]-(3-methoxy-4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 102965878 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | [3-fluoro-2-(methylamino)-4-pyridinyl]-(3-methoxy-4-methylpiperidin-1-yl)methanone |
| SMILES | CNc1nccc(C(=O)N2CCC(C)C(OC)C2)c1F |
| InChI | InChI=1S/C14H20FN3O2/c1-9-5-7-18(8-11(9)20-3)14(19)10-4-6-17-13(16-2)12(10)15/h4,6,9,11H,5,7-8H2,1-3H3,(H,16,17) |
| InChIKey | VEGGOVHHPBYZFE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |