C11H14FN3OS — CID 105387522
(2-amino-3-fluoro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone (PubChem CID 105387522) has the molecular formula C11H14FN3OS and a molecular weight of 255.32 g/mol. Its IUPAC name is (2-amino-3-fluoro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone.
| Compound Name | (2-amino-3-fluoro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 105387522 |
| Molecular Formula | C11H14FN3OS |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (2-amino-3-fluoro-4-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccnc(N)c2F)CCS1 |
| InChI | InChI=1S/C11H14FN3OS/c1-7-6-15(4-5-17-7)11(16)8-2-3-14-10(13)9(8)12/h2-3,7H,4-6H2,1H3,(H2,13,14) |
| InChIKey | ISHFUFZCHUVTGH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |