C11H16ClN3OS — CID 119999097
(6-amino-2-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride (PubChem CID 119999097) has the molecular formula C11H16ClN3OS and a molecular weight of 273.79 g/mol. Its IUPAC name is (6-amino-2-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride.
| Compound Name | (6-amino-2-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119999097 |
| Molecular Formula | C11H16ClN3OS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (6-amino-2-pyridinyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2cccc(N)n2)CCS1.Cl |
| InChI | InChI=1S/C11H15N3OS.ClH/c1-8-7-14(5-6-16-8)11(15)9-3-2-4-10(12)13-9;/h2-4,8H,5-7H2,1H3,(H2,12,13);1H |
| InChIKey | DWOCEKZFYVQWAD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |