C10H14N4O — CID 82507133
(6-amino-2-pyridinyl)-piperazin-1-ylmethanone (PubChem CID 82507133) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is (6-amino-2-pyridinyl)-piperazin-1-ylmethanone.
| Compound Name | (6-amino-2-pyridinyl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 82507133 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (6-amino-2-pyridinyl)-piperazin-1-ylmethanone |
| SMILES | Nc1cccc(C(=O)N2CCNCC2)n1 |
| InChI | InChI=1S/C10H14N4O/c11-9-3-1-2-8(13-9)10(15)14-6-4-12-5-7-14/h1-3,12H,4-7H2,(H2,11,13) |
| InChIKey | QCAXQTWMPVOMQN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |