C11H15N3O3S — CID 103832155
(6-amino-2-pyridinyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone (PubChem CID 103832155) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is (6-amino-2-pyridinyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone.
| Compound Name | (6-amino-2-pyridinyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 103832155 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (6-amino-2-pyridinyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
| SMILES | Nc1cccc(C(=O)N2CCCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C11H15N3O3S/c12-10-4-1-3-9(13-10)11(15)14-5-2-7-18(16,17)8-6-14/h1,3-4H,2,5-8H2,(H2,12,13) |
| InChIKey | YETAKHVPSQFMRR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |