C10H12N2O3S — CID 110743458
(1,1-dioxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone (PubChem CID 110743458) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110743458 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H12N2O3S/c13-10(9-3-1-2-4-11-9)12-5-7-16(14,15)8-6-12/h1-4H,5-8H2 |
| InChIKey | QRWIBELVPSFLOH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |