C15H23N5O3S — CID 55652947
[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-pyridin-2-ylmethanone (PubChem CID 55652947) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol. Its IUPAC name is [4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 55652947 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-pyridin-2-ylmethanone |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(C(=O)c3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C15H23N5O3S/c1-17-6-10-19(11-7-17)24(22,23)20-12-8-18(9-13-20)15(21)14-4-2-3-5-16-14/h2-5H,6-13H2,1H3 |
| InChIKey | CAOWBYXWJHECNF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 77.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |