C10H12N2O2S — CID 110743476
(1-oxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone (PubChem CID 110743476) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is (1-oxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone.
| Compound Name | (1-oxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110743476 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (1-oxo-1,4-thiazinan-4-yl)-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C10H12N2O2S/c13-10(9-3-1-2-4-11-9)12-5-7-15(14)8-6-12/h1-4H,5-8H2 |
| InChIKey | GCYREDOOZHTQGP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |