C10H9N3O3 — CID 66085705
4-(pyridine-2-carbonyl)piperazine-2,6-dione (PubChem CID 66085705) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 4-(pyridine-2-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(pyridine-2-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66085705 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-(pyridine-2-carbonyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2ccccn2)CC(=O)N1 |
| InChI | InChI=1S/C10H9N3O3/c14-8-5-13(6-9(15)12-8)10(16)7-3-1-2-4-11-7/h1-4H,5-6H2,(H,12,14,15) |
| InChIKey | NHANXMMIRHGQCT-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|