C10H10N4O3 — CID 66061658
4-(2-aminopyridine-3-carbonyl)piperazine-2,6-dione (PubChem CID 66061658) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-(2-aminopyridine-3-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(2-aminopyridine-3-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66061658 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-(2-aminopyridine-3-carbonyl)piperazine-2,6-dione |
| SMILES | Nc1ncccc1C(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C10H10N4O3/c11-9-6(2-1-3-12-9)10(17)14-4-7(15)13-8(16)5-14/h1-3H,4-5H2,(H2,11,12)(H,13,15,16) |
| InChIKey | HLIPZZZJWCBPGF-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|