C11H10ClN3O3 — CID 112576024
4-(3-amino-2-chlorobenzoyl)piperazine-2,6-dione (PubChem CID 112576024) has the molecular formula C11H10ClN3O3 and a molecular weight of 267.67 g/mol. Its IUPAC name is 4-(3-amino-2-chlorobenzoyl)piperazine-2,6-dione.
| Compound Name | 4-(3-amino-2-chlorobenzoyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 112576024 |
| Molecular Formula | C11H10ClN3O3 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-(3-amino-2-chlorobenzoyl)piperazine-2,6-dione |
| SMILES | Nc1cccc(C(=O)N2CC(=O)NC(=O)C2)c1Cl |
| InChI | InChI=1S/C11H10ClN3O3/c12-10-6(2-1-3-7(10)13)11(18)15-4-8(16)14-9(17)5-15/h1-3H,4-5,13H2,(H,14,16,17) |
| InChIKey | WQKXSECCUFSPOW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|