C11H8Cl2N2O3 — CID 66085866
4-(2,4-dichlorobenzoyl)piperazine-2,6-dione (PubChem CID 66085866) has the molecular formula C11H8Cl2N2O3 and a molecular weight of 287.10 g/mol. Its IUPAC name is 4-(2,4-dichlorobenzoyl)piperazine-2,6-dione.
| Compound Name | 4-(2,4-dichlorobenzoyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66085866 |
| Molecular Formula | C11H8Cl2N2O3 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 4-(2,4-dichlorobenzoyl)piperazine-2,6-dione |
| SMILES | O=C1CN(C(=O)c2ccc(Cl)cc2Cl)CC(=O)N1 |
| InChI | InChI=1S/C11H8Cl2N2O3/c12-6-1-2-7(8(13)3-6)11(18)15-4-9(16)14-10(17)5-15/h1-3H,4-5H2,(H,14,16,17) |
| InChIKey | AJWKPHDVAWFPTP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|