C11H10Cl2N2O2 — CID 30288935
4-(2,4-dichlorobenzoyl)piperazin-2-one (PubChem CID 30288935) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is 4-(2,4-dichlorobenzoyl)piperazin-2-one.
| Compound Name | 4-(2,4-dichlorobenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 30288935 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 4-(2,4-dichlorobenzoyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2ccc(Cl)cc2Cl)CCN1 |
| InChI | InChI=1S/C11H10Cl2N2O2/c12-7-1-2-8(9(13)5-7)11(17)15-4-3-14-10(16)6-15/h1-2,5H,3-4,6H2,(H,14,16) |
| InChIKey | NUFGSEWYWVXDKS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |