C12H13Cl2N3OS — CID 2050568
4-(2,4-dichlorobenzoyl)piperazine-1-carbothioamide (PubChem CID 2050568) has the molecular formula C12H13Cl2N3OS and a molecular weight of 318.23 g/mol. Its IUPAC name is 4-(2,4-dichlorobenzoyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2,4-dichlorobenzoyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2050568 |
| Molecular Formula | C12H13Cl2N3OS |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-(2,4-dichlorobenzoyl)piperazine-1-carbothioamide |
| SMILES | NC(=S)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C12H13Cl2N3OS/c13-8-1-2-9(10(14)7-8)11(18)16-3-5-17(6-4-16)12(15)19/h1-2,7H,3-6H2,(H2,15,19) |
| InChIKey | KQKJAJQWOYIDBO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|