C14H13Cl2N2O4- — CID 2050573
3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-oxopropanoate (PubChem CID 2050573) has the molecular formula C14H13Cl2N2O4- and a molecular weight of 344.17 g/mol. Its IUPAC name is 3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-oxopropanoate.
| Compound Name | 3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 2050573 |
| Molecular Formula | C14H13Cl2N2O4- |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-oxopropanoate |
| SMILES | O=C([O-])CC(=O)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H14Cl2N2O4/c15-9-1-2-10(11(16)7-9)14(22)18-5-3-17(4-6-18)12(19)8-13(20)21/h1-2,7H,3-6,8H2,(H,20,21)/p-1 |
| InChIKey | SYCYBINWNQTWRT-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|