C20H21Cl2N3O2 — CID 55823668
1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(N-methylanilino)ethanone (PubChem CID 55823668) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(N-methylanilino)ethanone.
| Compound Name | 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(N-methylanilino)ethanone |
|---|---|
| PubChem CID | 55823668 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-(N-methylanilino)ethanone |
| SMILES | CN(CC(=O)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H21Cl2N3O2/c1-23(16-5-3-2-4-6-16)14-19(26)24-9-11-25(12-10-24)20(27)17-8-7-15(21)13-18(17)22/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | PECAXHBAKWDBIR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |