C17H22Cl2N2O2 — CID 108569544
1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-ethylbutan-1-one (PubChem CID 108569544) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 108569544 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-3-12(4-2)16(22)20-7-9-21(10-8-20)17(23)14-6-5-13(18)11-15(14)19/h5-6,11-12H,3-4,7-10H2,1-2H3 |
| InChIKey | SMRIDHSWQGEWEB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |