C11H11Cl2NO2S — CID 110721545
(2,4-dichlorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 110721545) has the molecular formula C11H11Cl2NO2S and a molecular weight of 292.19 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 110721545 |
| Molecular Formula | C11H11Cl2NO2S |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | (2,4-dichlorophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H11Cl2NO2S/c12-8-1-2-9(10(13)7-8)11(15)14-3-5-17(16)6-4-14/h1-2,7H,3-6H2 |
| InChIKey | AQENBCHMJKPHSW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |