C18H15BrCl2N2O2 — CID 55660753
[4-(2-bromobenzoyl)piperazin-1-yl]-(2,4-dichlorophenyl)methanone (PubChem CID 55660753) has the molecular formula C18H15BrCl2N2O2 and a molecular weight of 442.14 g/mol. Its IUPAC name is [4-(2-bromobenzoyl)piperazin-1-yl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [4-(2-bromobenzoyl)piperazin-1-yl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 55660753 |
| Molecular Formula | C18H15BrCl2N2O2 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | [4-(2-bromobenzoyl)piperazin-1-yl]-(2,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCN(C(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C18H15BrCl2N2O2/c19-15-4-2-1-3-13(15)17(24)22-7-9-23(10-8-22)18(25)14-6-5-12(20)11-16(14)21/h1-6,11H,7-10H2 |
| InChIKey | PWNKILAZSOSEEB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |