C19H17BrCl2N2O2 — CID 166355375
(3-bromo-4-methylphenyl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone (PubChem CID 166355375) has the molecular formula C19H17BrCl2N2O2 and a molecular weight of 456.17 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone.
| Compound Name | (3-bromo-4-methylphenyl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166355375 |
| Molecular Formula | C19H17BrCl2N2O2 |
| Molecular Weight | 456.17 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | (3-bromo-4-methylphenyl)-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)cc1Br |
| InChI | InChI=1S/C19H17BrCl2N2O2/c1-12-2-3-13(10-16(12)20)18(25)23-6-8-24(9-7-23)19(26)15-5-4-14(21)11-17(15)22/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | MDJWJJPXCUBJIQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.17 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |