C24H22Cl2N2O — CID 1083374
(4-benzhydrylpiperazin-1-yl)-(2,4-dichlorophenyl)methanone (PubChem CID 1083374) has the molecular formula C24H22Cl2N2O and a molecular weight of 425.36 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-(2,4-dichlorophenyl)methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 1083374 |
| Molecular Formula | C24H22Cl2N2O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-(2,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H22Cl2N2O/c25-20-11-12-21(22(26)17-20)24(29)28-15-13-27(14-16-28)23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-12,17,23H,13-16H2 |
| InChIKey | GQSVKMYYHWBWKL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |