C24H22Cl2N2O2 — CID 177332987
2-chloro-4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]benzoic acid (PubChem CID 177332987) has the molecular formula C24H22Cl2N2O2 and a molecular weight of 441.36 g/mol. Its IUPAC name is 2-chloro-4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-chloro-4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 177332987 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-chloro-4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N2O2/c25-19-8-6-18(7-9-19)23(17-4-2-1-3-5-17)28-14-12-27(13-15-28)20-10-11-21(24(29)30)22(26)16-20/h1-11,16,23H,12-15H2,(H,29,30) |
| InChIKey | JLADBNMMEZLAAC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |