C18H20Cl2N2 — CID 7085144
1-(3,4-dichlorophenyl)-4-[(1R)-1-phenylethyl]piperazine (PubChem CID 7085144) has the molecular formula C18H20Cl2N2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-[(1R)-1-phenylethyl]piperazine.
| Compound Name | 1-(3,4-dichlorophenyl)-4-[(1R)-1-phenylethyl]piperazine |
|---|---|
| PubChem CID | 7085144 |
| Molecular Formula | C18H20Cl2N2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-[(1R)-1-phenylethyl]piperazine |
| SMILES | C[C@H](c1ccccc1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H20Cl2N2/c1-14(15-5-3-2-4-6-15)21-9-11-22(12-10-21)16-7-8-17(19)18(20)13-16/h2-8,13-14H,9-12H2,1H3/t14-/m1/s1 |
| InChIKey | YFARKOXLNOAESC-CQSZACIVSA-N |
| XLogP | 4.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |