C20H23Cl2N3O — CID 87769902
2-(aminomethyl)-3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-phenylpropanal (PubChem CID 87769902) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is 2-(aminomethyl)-3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-phenylpropanal.
| Compound Name | 2-(aminomethyl)-3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-phenylpropanal |
|---|---|
| PubChem CID | 87769902 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-(aminomethyl)-3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-3-phenylpropanal |
| SMILES | NCC(C=O)C(c1ccccc1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H23Cl2N3O/c21-18-7-6-17(12-19(18)22)24-8-10-25(11-9-24)20(16(13-23)14-26)15-4-2-1-3-5-15/h1-7,12,14,16,20H,8-11,13,23H2 |
| InChIKey | DXIODHYLILKVRN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|