C20H23Cl2N3O — CID 22198819
2-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide (PubChem CID 22198819) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 22198819 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CN1CCN(c2ccc(Cl)c(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H23Cl2N3O/c1-15(16-5-3-2-4-6-16)23-20(26)14-24-9-11-25(12-10-24)17-7-8-18(21)19(22)13-17/h2-8,13,15H,9-12,14H2,1H3,(H,23,26) |
| InChIKey | RMFRIXICXGIWCF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |