C13H16Cl2N2O2 — CID 22337271
3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propanoic acid (PubChem CID 22337271) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 22337271 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c14-11-2-1-10(9-12(11)15)17-7-5-16(6-8-17)4-3-13(18)19/h1-2,9H,3-8H2,(H,18,19) |
| InChIKey | NIYLVQSMGFJCMP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |