C21H22Cl2N2O2 — CID 4167422
1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione (PubChem CID 4167422) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione.
| Compound Name | 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 4167422 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H22Cl2N2O2/c22-18-10-9-17(15-19(18)23)24-11-13-25(14-12-24)21(27)8-4-7-20(26)16-5-2-1-3-6-16/h1-3,5-6,9-10,15H,4,7-8,11-14H2 |
| InChIKey | UTNIBCPWYOWCKY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |