C21H23ClN2O2 — CID 20969074
1-[4-(3-chlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione (PubChem CID 20969074) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione |
|---|---|
| PubChem CID | 20969074 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-5-phenylpentane-1,5-dione |
| SMILES | O=C(CCCC(=O)N1CCN(c2cccc(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O2/c22-18-8-4-9-19(16-18)23-12-14-24(15-13-23)21(26)11-5-10-20(25)17-6-2-1-3-7-17/h1-4,6-9,16H,5,10-15H2 |
| InChIKey | QSPVFRDBYAKQLS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |