C30H30Cl3N5OS — CID 4303313
5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]pentan-1-one (PubChem CID 4303313) has the molecular formula C30H30Cl3N5OS and a molecular weight of 615.03 g/mol. Its IUPAC name is 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 4303313 |
| Molecular Formula | C30H30Cl3N5OS |
| Molecular Weight | 615.03 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCSc1nnc(Cc2ccccc2)n1-c1ccc(Cl)c(Cl)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C30H30Cl3N5OS/c31-23-9-6-10-24(20-23)36-14-16-37(17-15-36)29(39)11-4-5-18-40-30-35-34-28(19-22-7-2-1-3-8-22)38(30)25-12-13-26(32)27(33)21-25/h1-3,6-10,12-13,20-21H,4-5,11,14-19H2 |
| InChIKey | FZBWKJKVQWTAON-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.03 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|