C32H35Cl2N5OS — CID 42741962
5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-benzylpiperidin-4-yl)pentanamide (PubChem CID 42741962) has the molecular formula C32H35Cl2N5OS and a molecular weight of 608.64 g/mol. Its IUPAC name is 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-benzylpiperidin-4-yl)pentanamide.
| Compound Name | 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-benzylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 42741962 |
| Molecular Formula | C32H35Cl2N5OS |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-benzylpiperidin-4-yl)pentanamide |
| SMILES | O=C(CCCCSc1nnc(Cc2ccccc2)n1-c1ccc(Cl)c(Cl)c1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H35Cl2N5OS/c33-28-15-14-27(22-29(28)34)39-30(21-24-9-3-1-4-10-24)36-37-32(39)41-20-8-7-13-31(40)35-26-16-18-38(19-17-26)23-25-11-5-2-6-12-25/h1-6,9-12,14-15,22,26H,7-8,13,16-21,23H2,(H,35,40) |
| InChIKey | MKAUCBRZECZGKC-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|