C31H33Cl2N5OS — CID 42741963
5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-benzylpiperazin-1-yl)pentan-1-one (PubChem CID 42741963) has the molecular formula C31H33Cl2N5OS and a molecular weight of 594.61 g/mol. Its IUPAC name is 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-benzylpiperazin-1-yl)pentan-1-one.
| Compound Name | 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-benzylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 42741963 |
| Molecular Formula | C31H33Cl2N5OS |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 5-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-benzylpiperazin-1-yl)pentan-1-one |
| SMILES | O=C(CCCCSc1nnc(Cc2ccccc2)n1-c1ccc(Cl)c(Cl)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H33Cl2N5OS/c32-27-15-14-26(22-28(27)33)38-29(21-24-9-3-1-4-10-24)34-35-31(38)40-20-8-7-13-30(39)37-18-16-36(17-19-37)23-25-11-5-2-6-12-25/h1-6,9-12,14-15,22H,7-8,13,16-21,23H2 |
| InChIKey | NQQYHECQYARSKF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|