C25H29Cl2N5OS — CID 42741996
4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-ethylpiperazin-1-yl)butan-1-one (PubChem CID 42741996) has the molecular formula C25H29Cl2N5OS and a molecular weight of 518.51 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-ethylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-ethylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 42741996 |
| Molecular Formula | C25H29Cl2N5OS |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-ethylpiperazin-1-yl)butan-1-one |
| SMILES | CCN1CCN(C(=O)CCCSc2nnc(Cc3ccccc3)n2-c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C25H29Cl2N5OS/c1-2-30-12-14-31(15-13-30)24(33)9-6-16-34-25-29-28-23(17-19-7-4-3-5-8-19)32(25)20-10-11-21(26)22(27)18-20/h3-5,7-8,10-11,18H,2,6,9,12-17H2,1H3 |
| InChIKey | TWMTULDQOHCOAN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|