C23H26Cl2N4OS — CID 5040841
4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)butanamide (PubChem CID 5040841) has the molecular formula C23H26Cl2N4OS and a molecular weight of 477.46 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)butanamide.
| Compound Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 5040841 |
| Molecular Formula | C23H26Cl2N4OS |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropyl)butanamide |
| SMILES | CC(C)CNC(=O)CCCSc1nnc(Cc2ccccc2)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H26Cl2N4OS/c1-16(2)15-26-22(30)9-6-12-31-23-28-27-21(13-17-7-4-3-5-8-17)29(23)18-10-11-19(24)20(25)14-18/h3-5,7-8,10-11,14,16H,6,9,12-13,15H2,1-2H3,(H,26,30) |
| InChIKey | JUAAWZKJRMEHPW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|