C25H28Cl2N4OS — CID 42741981
4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide (PubChem CID 42741981) has the molecular formula C25H28Cl2N4OS and a molecular weight of 503.50 g/mol. Its IUPAC name is 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide.
| Compound Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 42741981 |
| Molecular Formula | C25H28Cl2N4OS |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 4-[[5-benzyl-4-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide |
| SMILES | O=C(CCCSc1nnc(Cc2ccccc2)n1-c1ccc(Cl)c(Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C25H28Cl2N4OS/c26-21-14-13-20(17-22(21)27)31-23(16-18-8-3-1-4-9-18)29-30-25(31)33-15-7-12-24(32)28-19-10-5-2-6-11-19/h1,3-4,8-9,13-14,17,19H,2,5-7,10-12,15-16H2,(H,28,32) |
| InChIKey | IXAFUMLKHIWDMR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|