C24H27ClN4OS — CID 42741591
4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide (PubChem CID 42741591) has the molecular formula C24H27ClN4OS and a molecular weight of 455.03 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide.
| Compound Name | 4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 42741591 |
| Molecular Formula | C24H27ClN4OS |
| Molecular Weight | 455.03 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-cyclohexylbutanamide |
| SMILES | O=C(CCCSc1nnc(-c2ccc(Cl)cc2)n1-c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C24H27ClN4OS/c25-19-15-13-18(14-16-19)23-27-28-24(29(23)21-10-5-2-6-11-21)31-17-7-12-22(30)26-20-8-3-1-4-9-20/h2,5-6,10-11,13-16,20H,1,3-4,7-9,12,17H2,(H,26,30) |
| InChIKey | GJYABCLOSIGHFM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.03 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|