C24H27ClN4O2S — CID 42741621
4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,6-dimethylmorpholin-4-yl)butan-1-one (PubChem CID 42741621) has the molecular formula C24H27ClN4O2S and a molecular weight of 471.03 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,6-dimethylmorpholin-4-yl)butan-1-one.
| Compound Name | 4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,6-dimethylmorpholin-4-yl)butan-1-one |
|---|---|
| PubChem CID | 42741621 |
| Molecular Formula | C24H27ClN4O2S |
| Molecular Weight | 471.03 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,6-dimethylmorpholin-4-yl)butan-1-one |
| SMILES | CC1CN(C(=O)CCCSc2nnc(-c3ccc(Cl)cc3)n2-c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C24H27ClN4O2S/c1-17-15-28(16-18(2)31-17)22(30)9-6-14-32-24-27-26-23(19-10-12-20(25)13-11-19)29(24)21-7-4-3-5-8-21/h3-5,7-8,10-13,17-18H,6,9,14-16H2,1-2H3 |
| InChIKey | UNZFQDVQMLGSHG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|