C29H30FN5OS — CID 3412680
1-[4-(2-fluorophenyl)piperazin-1-yl]-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one (PubChem CID 3412680) has the molecular formula C29H30FN5OS and a molecular weight of 515.66 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 3412680 |
| Molecular Formula | C29H30FN5OS |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-4-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-one |
| SMILES | Cc1ccc(-c2nnc(SCCCC(=O)N3CCN(c4ccccc4F)CC3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30FN5OS/c1-22-13-15-23(16-14-22)28-31-32-29(35(28)24-8-3-2-4-9-24)37-21-7-12-27(36)34-19-17-33(18-20-34)26-11-6-5-10-25(26)30/h2-6,8-11,13-16H,7,12,17-21H2,1H3 |
| InChIKey | QWUTWKXNNKMGEU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|