C31H41N5O2S — CID 42742671
1-[2-methyl-4-[5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperazin-1-yl]hexan-1-one (PubChem CID 42742671) has the molecular formula C31H41N5O2S and a molecular weight of 547.77 g/mol. Its IUPAC name is 1-[2-methyl-4-[5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 1-[2-methyl-4-[5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 42742671 |
| Molecular Formula | C31H41N5O2S |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | 1-[2-methyl-4-[5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(C(=O)CCCCSc2nnc(-c3ccc(C)cc3)n2-c2ccccc2)CC1C |
| InChI | InChI=1S/C31H41N5O2S/c1-4-5-7-15-29(38)35-21-20-34(23-25(35)3)28(37)14-10-11-22-39-31-33-32-30(26-18-16-24(2)17-19-26)36(31)27-12-8-6-9-13-27/h6,8-9,12-13,16-19,25H,4-5,7,10-11,14-15,20-23H2,1-3H3 |
| InChIKey | JSHZHYJPTCGEQP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|