C29H37N5O2S — CID 42742661
1-(4-butanoyl-3-methylpiperazin-1-yl)-5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one (PubChem CID 42742661) has the molecular formula C29H37N5O2S and a molecular weight of 519.72 g/mol. Its IUPAC name is 1-(4-butanoyl-3-methylpiperazin-1-yl)-5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one.
| Compound Name | 1-(4-butanoyl-3-methylpiperazin-1-yl)-5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one |
|---|---|
| PubChem CID | 42742661 |
| Molecular Formula | C29H37N5O2S |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 1-(4-butanoyl-3-methylpiperazin-1-yl)-5-[[5-(4-methylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one |
| SMILES | CCCC(=O)N1CCN(C(=O)CCCCSc2nnc(-c3ccc(C)cc3)n2-c2ccccc2)CC1C |
| InChI | InChI=1S/C29H37N5O2S/c1-4-10-27(36)33-19-18-32(21-23(33)3)26(35)13-8-9-20-37-29-31-30-28(24-16-14-22(2)15-17-24)34(29)25-11-6-5-7-12-25/h5-7,11-12,14-17,23H,4,8-10,13,18-21H2,1-3H3 |
| InChIKey | FVOLSDRIJREYQU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|