C31H32ClN5O2S — CID 3562550
1-[4-(2-chlorobenzoyl)-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one (PubChem CID 3562550) has the molecular formula C31H32ClN5O2S and a molecular weight of 574.15 g/mol. Its IUPAC name is 1-[4-(2-chlorobenzoyl)-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one.
| Compound Name | 1-[4-(2-chlorobenzoyl)-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
|---|---|
| PubChem CID | 3562550 |
| Molecular Formula | C31H32ClN5O2S |
| Molecular Weight | 574.15 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 1-[4-(2-chlorobenzoyl)-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
| SMILES | CC1CN(C(=O)CCCCSc2nnc(-c3ccccc3)n2-c2ccccc2)CCN1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C31H32ClN5O2S/c1-23-22-35(19-20-36(23)30(39)26-16-8-9-17-27(26)32)28(38)18-10-11-21-40-31-34-33-29(24-12-4-2-5-13-24)37(31)25-14-6-3-7-15-25/h2-9,12-17,23H,10-11,18-22H2,1H3 |
| InChIKey | VDCAWMWDYKOCGF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.15 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|