C33H31F6N5O2S — CID 4003945
1-[4-[3,5-bis(trifluoromethyl)benzoyl]-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one (PubChem CID 4003945) has the molecular formula C33H31F6N5O2S and a molecular weight of 675.70 g/mol. Its IUPAC name is 1-[4-[3,5-bis(trifluoromethyl)benzoyl]-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one.
| Compound Name | 1-[4-[3,5-bis(trifluoromethyl)benzoyl]-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
|---|---|
| PubChem CID | 4003945 |
| Molecular Formula | C33H31F6N5O2S |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 1-[4-[3,5-bis(trifluoromethyl)benzoyl]-3-methylpiperazin-1-yl]-5-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]pentan-1-one |
| SMILES | CC1CN(C(=O)CCCCSc2nnc(-c3ccccc3)n2-c2ccccc2)CCN1C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H31F6N5O2S/c1-22-21-42(15-16-43(22)30(46)24-18-25(32(34,35)36)20-26(19-24)33(37,38)39)28(45)14-8-9-17-47-31-41-40-29(23-10-4-2-5-11-23)44(31)27-12-6-3-7-13-27/h2-7,10-13,18-20,22H,8-9,14-17,21H2,1H3 |
| InChIKey | IDAVWPIJDKGYPS-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|