C32H34FN5O2S — CID 3447284
4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one (PubChem CID 3447284) has the molecular formula C32H34FN5O2S and a molecular weight of 571.72 g/mol. Its IUPAC name is 4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 3447284 |
| Molecular Formula | C32H34FN5O2S |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 4-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[4-(3-fluorobenzoyl)-3-methylpiperazin-1-yl]butan-1-one |
| SMILES | Cc1ccc(-c2nnc(SCCCC(=O)N3CCN(C(=O)c4cccc(F)c4)C(C)C3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H34FN5O2S/c1-22-9-13-25(14-10-22)30-34-35-32(38(30)28-15-11-23(2)12-16-28)41-19-5-8-29(39)36-17-18-37(24(3)21-36)31(40)26-6-4-7-27(33)20-26/h4,6-7,9-16,20,24H,5,8,17-19,21H2,1-3H3 |
| InChIKey | NUOHOIFMDJKUEI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|