C29H30N6O5S — CID 42731647
4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 42731647) has the molecular formula C29H30N6O5S and a molecular weight of 574.66 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 42731647 |
| Molecular Formula | C29H30N6O5S |
| Molecular Weight | 574.66 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(3-nitrobenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | Cc1ccc(-n2c(SCCCC(=O)N3CCN(C(=O)c4cccc([N+](=O)[O-])c4)C(C)C3)nnc2-c2ccco2)cc1 |
| InChI | InChI=1S/C29H30N6O5S/c1-20-10-12-23(13-11-20)34-27(25-8-4-16-40-25)30-31-29(34)41-17-5-9-26(36)32-14-15-33(21(2)19-32)28(37)22-6-3-7-24(18-22)35(38)39/h3-4,6-8,10-13,16,18,21H,5,9,14-15,17,19H2,1-2H3 |
| InChIKey | NFXBNGDCFUOBHE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 127.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|