C31H32N6O5S — CID 42731658
4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]butan-1-one (PubChem CID 42731658) has the molecular formula C31H32N6O5S and a molecular weight of 600.70 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 42731658 |
| Molecular Formula | C31H32N6O5S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 4-[[5-(furan-2-yl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1ccc(-n2c(SCCCC(=O)N3CCN(C(=O)/C=C/c4ccc([N+](=O)[O-])cc4)C(C)C3)nnc2-c2ccco2)cc1 |
| InChI | InChI=1S/C31H32N6O5S/c1-22-7-12-25(13-8-22)36-30(27-5-3-19-42-27)32-33-31(36)43-20-4-6-28(38)34-17-18-35(23(2)21-34)29(39)16-11-24-9-14-26(15-10-24)37(40)41/h3,5,7-16,19,23H,4,6,17-18,20-21H2,1-2H3/b16-11+ |
| InChIKey | AWGHYFNHPJOFGG-LFIBNONCSA-N |
| XLogP | 5.39 |
| TPSA | 127.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|