C33H36N6O4S — CID 5182894
5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]pentan-1-one (PubChem CID 5182894) has the molecular formula C33H36N6O4S and a molecular weight of 612.76 g/mol. Its IUPAC name is 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 5182894 |
| Molecular Formula | C33H36N6O4S |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-nitrobenzoyl)piperazin-1-yl]pentan-1-one |
| SMILES | Cc1ccc(-n2c(Cc3ccccc3)nnc2SCCCCC(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)C(C)C2)cc1 |
| InChI | InChI=1S/C33H36N6O4S/c1-24-11-15-28(16-12-24)38-30(22-26-8-4-3-5-9-26)34-35-33(38)44-21-7-6-10-31(40)36-19-20-37(25(2)23-36)32(41)27-13-17-29(18-14-27)39(42)43/h3-5,8-9,11-18,25H,6-7,10,19-23H2,1-2H3 |
| InChIKey | UBASENNRIBRVRE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|