C38H47N5O2S — CID 3960737
5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]pentan-1-one (PubChem CID 3960737) has the molecular formula C38H47N5O2S and a molecular weight of 637.89 g/mol. Its IUPAC name is 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 3960737 |
| Molecular Formula | C38H47N5O2S |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.35 |
| IUPAC Name | 5-[[5-benzyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]pentan-1-one |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(C(=O)CCCCSc3nnc(Cc4ccccc4)n3-c3ccc(C)cc3)CC2C)cc1 |
| InChI | InChI=1S/C38H47N5O2S/c1-4-5-7-12-31-18-20-33(21-19-31)37(45)42-25-24-41(28-30(42)3)36(44)15-10-11-26-46-38-40-39-35(27-32-13-8-6-9-14-32)43(38)34-22-16-29(2)17-23-34/h6,8-9,13-14,16-23,30H,4-5,7,10-12,15,24-28H2,1-3H3 |
| InChIKey | PYMCAAZEKVFXBZ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|