C35H40ClN5O2S — CID 3988038
4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one (PubChem CID 3988038) has the molecular formula C35H40ClN5O2S and a molecular weight of 630.26 g/mol. Its IUPAC name is 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 3988038 |
| Molecular Formula | C35H40ClN5O2S |
| Molecular Weight | 630.26 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]butan-1-one |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(C(=O)CCCSc3nnc(-c4ccccc4Cl)n3-c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C35H40ClN5O2S/c1-3-4-6-12-27-18-20-28(21-19-27)34(43)40-23-22-39(25-26(40)2)32(42)17-11-24-44-35-38-37-33(30-15-9-10-16-31(30)36)41(35)29-13-7-5-8-14-29/h5,7-10,13-16,18-21,26H,3-4,6,11-12,17,22-25H2,1-2H3 |
| InChIKey | JXMGVTYGRHHSND-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.26 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|